About [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol
[6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol (PubChem CID 150025365) has the molecular formula C11H17ClN2O
and a molecular weight of 228.72 g/mol. Its IUPAC name is [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol |
| PubChem CID | 150025365 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol |
| SMILES | CC(C)(C)CNc1cc(Cl)ncc1CO |
| InChI | InChI=1S/C11H17ClN2O/c1-11(2,3)7-14-9-4-10(12)13-5-8(9)6-15/h4-5,15H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | DGCSELCORUUWIS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol?
The IUPAC name of [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol (CID 150025365) is [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol.
What is the SMILES notation for [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol?
The canonical SMILES for [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol is CC(C)(C)CNc1cc(Cl)ncc1CO.
What is the InChIKey of [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol?
The InChIKey is DGCSELCORUUWIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2O/c1-11(2,3)7-14-9-4-10(12)13-5-8(9)6-15/h4-5,15H,6-7H2,1-3H3,(H,13,14).
What are the key properties of [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol?
[6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol has a molecular weight of 228.72 g/mol, XLogP of 2.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-4-(2,2-dimethylpropylamino)-3-pyridinyl]methanol is sourced from PubChem (CID 150025365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).