About 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid
2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 150027506) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| PubChem CID | 150027506 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC=C1C(C(=O)O)=CC=CC1(C)C(=O)O |
| InChI | InChI=1S/C11H12O4/c1-3-8-7(9(12)13)5-4-6-11(8,2)10(14)15/h3-6H,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | DGNYBWQFOPOLKI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The IUPAC name of 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (CID 150027506) is 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
What is the SMILES notation for 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The canonical SMILES for 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid is CC=C1C(C(=O)O)=CC=CC1(C)C(=O)O.
What is the InChIKey of 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
The InChIKey is DGNYBWQFOPOLKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-3-8-7(9(12)13)5-4-6-11(8,2)10(14)15/h3-6H,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid?
2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid has a molecular weight of 208.21 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidene-1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid is sourced from PubChem (CID 150027506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).