C14H28N2O — CID 150027975
2-(3-imino-2,4-dimethylpentan-2-yl)oxy-2,4-dimethylpentan-3-imine (PubChem CID 150027975) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-(3-imino-2,4-dimethylpentan-2-yl)oxy-2,4-dimethylpentan-3-imine.
| Compound Name | 2-(3-imino-2,4-dimethylpentan-2-yl)oxy-2,4-dimethylpentan-3-imine |
|---|---|
| PubChem CID | 150027975 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | 2-(3-imino-2,4-dimethylpentan-2-yl)oxy-2,4-dimethylpentan-3-imine |
| SMILES | [H]/N=C(\C(C)C)C(C)(C)OC(C)(C)/C(=N/[H])C(C)C |
| InChI | InChI=1S/C14H28N2O/c1-9(2)11(15)13(5,6)17-14(7,8)12(16)10(3)4/h9-10,15-16H,1-8H3/b15-11+,16-12+ |
| InChIKey | DGQKWEVOQOBEFG-JOBJLJCHSA-N |
| XLogP | 3.91 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|