About 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine
2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine (PubChem CID 150028153) has the molecular formula C9H9ClN2
and a molecular weight of 180.64 g/mol. Its IUPAC name is 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine |
| PubChem CID | 150028153 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine |
| SMILES | Cc1cncc2cc(Cl)n(C)c12 |
| InChI | InChI=1S/C9H9ClN2/c1-6-4-11-5-7-3-8(10)12(2)9(6)7/h3-5H,1-2H3 |
| InChIKey | DGRILAOXCTWXMK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine?
The IUPAC name of 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine (CID 150028153) is 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine.
What is the SMILES notation for 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine?
The canonical SMILES for 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine is Cc1cncc2cc(Cl)n(C)c12.
What is the InChIKey of 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine?
The InChIKey is DGRILAOXCTWXMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2/c1-6-4-11-5-7-3-8(10)12(2)9(6)7/h3-5H,1-2H3.
What are the key properties of 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine?
2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine has a molecular weight of 180.64 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,7-dimethylpyrrolo[3,2-c]pyridine is sourced from PubChem (CID 150028153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).