About 4-(iodomethyl)-1,3-dioxan-2-one
4-(iodomethyl)-1,3-dioxan-2-one (PubChem CID 150028577) has the molecular formula C5H7IO3
and a molecular weight of 242.01 g/mol. Its IUPAC name is 4-(iodomethyl)-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 4-(iodomethyl)-1,3-dioxan-2-one |
| PubChem CID | 150028577 |
| Molecular Formula | C5H7IO3 |
| Molecular Weight | 242.01 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | 4-(iodomethyl)-1,3-dioxan-2-one |
| SMILES | O=C1OCCC(CI)O1 |
| InChI | InChI=1S/C5H7IO3/c6-3-4-1-2-8-5(7)9-4/h4H,1-3H2 |
| InChIKey | DGTOWBUZVVFKAI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.01 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(iodomethyl)-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(iodomethyl)-1,3-dioxan-2-one?
The IUPAC name of 4-(iodomethyl)-1,3-dioxan-2-one (CID 150028577) is 4-(iodomethyl)-1,3-dioxan-2-one.
What is the SMILES notation for 4-(iodomethyl)-1,3-dioxan-2-one?
The canonical SMILES for 4-(iodomethyl)-1,3-dioxan-2-one is O=C1OCCC(CI)O1.
What is the InChIKey of 4-(iodomethyl)-1,3-dioxan-2-one?
The InChIKey is DGTOWBUZVVFKAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7IO3/c6-3-4-1-2-8-5(7)9-4/h4H,1-3H2.
What are the key properties of 4-(iodomethyl)-1,3-dioxan-2-one?
4-(iodomethyl)-1,3-dioxan-2-one has a molecular weight of 242.01 g/mol, XLogP of 1.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(iodomethyl)-1,3-dioxan-2-one is sourced from PubChem (CID 150028577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).