About 3-methoxy-6-phenyl-1,2,4,5-tetrazine
3-methoxy-6-phenyl-1,2,4,5-tetrazine (PubChem CID 15002866) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-methoxy-6-phenyl-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-methoxy-6-phenyl-1,2,4,5-tetrazine |
| PubChem CID | 15002866 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-methoxy-6-phenyl-1,2,4,5-tetrazine |
| SMILES | COc1nnc(-c2ccccc2)nn1 |
| InChI | InChI=1S/C9H8N4O/c1-14-9-12-10-8(11-13-9)7-5-3-2-4-6-7/h2-6H,1H3 |
| InChIKey | HNZNXFVRHNKOEE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxy-6-phenyl-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-6-phenyl-1,2,4,5-tetrazine?
The IUPAC name of 3-methoxy-6-phenyl-1,2,4,5-tetrazine (CID 15002866) is 3-methoxy-6-phenyl-1,2,4,5-tetrazine.
What is the SMILES notation for 3-methoxy-6-phenyl-1,2,4,5-tetrazine?
The canonical SMILES for 3-methoxy-6-phenyl-1,2,4,5-tetrazine is COc1nnc(-c2ccccc2)nn1.
What is the InChIKey of 3-methoxy-6-phenyl-1,2,4,5-tetrazine?
The InChIKey is HNZNXFVRHNKOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c1-14-9-12-10-8(11-13-9)7-5-3-2-4-6-7/h2-6H,1H3.
What are the key properties of 3-methoxy-6-phenyl-1,2,4,5-tetrazine?
3-methoxy-6-phenyl-1,2,4,5-tetrazine has a molecular weight of 188.19 g/mol, XLogP of 0.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-6-phenyl-1,2,4,5-tetrazine is sourced from PubChem (CID 15002866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).