C24H22BClF2N4O10 — CID 150029609
(3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-6,7-difluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 150029609) has the molecular formula C24H22BClF2N4O10 and a molecular weight of 610.72 g/mol. Its IUPAC name is (3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-6,7-difluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-6,7-difluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 150029609 |
| Molecular Formula | C24H22BClF2N4O10 |
| Molecular Weight | 610.72 g/mol |
| Exact Mass | 610.11 |
| IUPAC Name | (3R)-3-[[2-(2-chloro-3,4-dihydroxyphenyl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-6,7-difluoro-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cc(F)c(F)c(C(=O)O)c3OB2O)c2ccc(O)c(O)c2Cl)C(=O)C1=O |
| InChI | InChI=1S/C24H22BClF2N4O10/c1-2-31-5-6-32(22(37)21(31)36)24(40)30-17(10-3-4-12(33)18(34)15(10)26)20(35)29-13-8-9-7-11(27)16(28)14(23(38)39)19(9)42-25(13)41/h3-4,7,13,17,33-34,41H,2,5-6,8H2,1H3,(H,29,35)(H,30,40)(H,38,39)/t13-,17?/m0/s1 |
| InChIKey | DGYYUNVRAQVERM-CWQZNGJJSA-N |
| XLogP | 0.31 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.72 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|