About 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine
2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine (PubChem CID 150029728) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine.
Molecular Properties
| Compound Name | 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine |
| PubChem CID | 150029728 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine |
| SMILES | CC(C)N(C(C)C)C1(Cl)COCCO1 |
| InChI | InChI=1S/C10H20ClNO2/c1-8(2)12(9(3)4)10(11)7-13-5-6-14-10/h8-9H,5-7H2,1-4H3 |
| InChIKey | DGZOUFPPEOOXCT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine?
The IUPAC name of 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine (CID 150029728) is 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine.
What is the SMILES notation for 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine?
The canonical SMILES for 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine is CC(C)N(C(C)C)C1(Cl)COCCO1.
What is the InChIKey of 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine?
The InChIKey is DGZOUFPPEOOXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClNO2/c1-8(2)12(9(3)4)10(11)7-13-5-6-14-10/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine?
2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine has a molecular weight of 221.73 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-di(propan-2-yl)-1,4-dioxan-2-amine is sourced from PubChem (CID 150029728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).