C19H23ClN4O3 — CID 150030163
2-[6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]amino]-1,5-naphthyridin-3-yl]-2-oxoacetic acid (PubChem CID 150030163) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-[6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]amino]-1,5-naphthyridin-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]amino]-1,5-naphthyridin-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 150030163 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-[6-chloro-4-[[4-[(dimethylamino)methyl]cyclohexyl]amino]-1,5-naphthyridin-3-yl]-2-oxoacetic acid |
| SMILES | CN(C)CC1CCC(Nc2c(C(=O)C(=O)O)cnc3ccc(Cl)nc23)CC1 |
| InChI | InChI=1S/C19H23ClN4O3/c1-24(2)10-11-3-5-12(6-4-11)22-16-13(18(25)19(26)27)9-21-14-7-8-15(20)23-17(14)16/h7-9,11-12H,3-6,10H2,1-2H3,(H,21,22)(H,26,27) |
| InChIKey | DHBSQQIKBNLIAV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|