4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid

C8H8BrFO2 — CID 150030745

IUPAC4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid
SMILESCC1(F)C=C(Br)C=CC1C(=O)O
InChIInChI=1S/C8H8BrFO2/c1-8(10)4-5(9)2-3-6(8)7(11)12/h2-4,6H,1H3,(H,11,12)
InChIKeyDHFBFDPHINYTLS-UHFFFAOYSA-N
MW235.05 g/mol
LogP2.26
Rot. Bonds1

About 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid

4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 150030745) has the molecular formula C8H8BrFO2 and a molecular weight of 235.05 g/mol. Its IUPAC name is 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid
PubChem CID150030745
Molecular FormulaC8H8BrFO2
Molecular Weight235.05 g/mol
Exact Mass233.97
IUPAC Name4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid
SMILESCC1(F)C=C(Br)C=CC1C(=O)O
InChIInChI=1S/C8H8BrFO2/c1-8(10)4-5(9)2-3-6(8)7(11)12/h2-4,6H,1H3,(H,11,12)
InChIKeyDHFBFDPHINYTLS-UHFFFAOYSA-N
XLogP2.26
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.05
LogP ≤ 52.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid (CID 150030745) is 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid is CC1(F)C=C(Br)C=CC1C(=O)O.
What is the InChIKey of 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is DHFBFDPHINYTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrFO2/c1-8(10)4-5(9)2-3-6(8)7(11)12/h2-4,6H,1H3,(H,11,12).
What are the key properties of 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid?
4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 235.05 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-fluoro-6-methylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 150030745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).