About 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid
1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid (PubChem CID 150032332) has the molecular formula C7H7F3N2O2
and a molecular weight of 208.14 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid |
| PubChem CID | 150032332 |
| Molecular Formula | C7H7F3N2O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CCC(F)(F)F)cn1 |
| InChI | InChI=1S/C7H7F3N2O2/c8-7(9,10)1-2-12-3-5(6(13)14)11-4-12/h3-4H,1-2H2,(H,13,14) |
| InChIKey | DHNKFOSGMUVSHU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid?
The IUPAC name of 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid (CID 150032332) is 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid.
What is the SMILES notation for 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid?
The canonical SMILES for 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid is O=C(O)c1cn(CCC(F)(F)F)cn1.
What is the InChIKey of 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid?
The InChIKey is DHNKFOSGMUVSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O2/c8-7(9,10)1-2-12-3-5(6(13)14)11-4-12/h3-4H,1-2H2,(H,13,14).
What are the key properties of 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid?
1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid has a molecular weight of 208.14 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3,3-trifluoropropyl)imidazole-4-carboxylic acid is sourced from PubChem (CID 150032332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).