C22H32Si — CID 150033571
2,3,3a,4-tetrahydro-1H-inden-1-yl-[1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]silane (PubChem CID 150033571) has the molecular formula C22H32Si and a molecular weight of 324.58 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-inden-1-yl-[1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]silane.
| Compound Name | 2,3,3a,4-tetrahydro-1H-inden-1-yl-[1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 150033571 |
| Molecular Formula | C22H32Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-inden-1-yl-[1-(cyclohexylmethyl)cyclohexa-2,4-dien-1-yl]silane |
| SMILES | C1=CCC2CCC([SiH2]C3(CC4CCCCC4)C=CC=CC3)C2=C1 |
| InChI | InChI=1S/C22H32Si/c1-3-9-18(10-4-1)17-22(15-7-2-8-16-22)23-21-14-13-19-11-5-6-12-20(19)21/h2,5-8,12,15,18-19,21H,1,3-4,9-11,13-14,16-17,23H2 |
| InChIKey | DHTWOPUYRMKBAS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|