About [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone
[1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone (PubChem CID 150034407) has the molecular formula C24H29N3O2
and a molecular weight of 391.52 g/mol. Its IUPAC name is [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone |
| PubChem CID | 150034407 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone |
| SMILES | CCCCCCN1CC=C(c2cn(N)c3ccc(C(=O)c4ccco4)cc23)CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-3-4-5-12-26-13-10-18(11-14-26)21-17-27(25)22-9-8-19(16-20(21)22)24(28)23-7-6-15-29-23/h6-10,15-17H,2-5,11-14,25H2,1H3 |
| InChIKey | DHYIMETWPFBNCC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone?
The IUPAC name of [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone (CID 150034407) is [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone.
What is the SMILES notation for [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone?
The canonical SMILES for [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone is CCCCCCN1CC=C(c2cn(N)c3ccc(C(=O)c4ccco4)cc23)CC1.
What is the InChIKey of [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone?
The InChIKey is DHYIMETWPFBNCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2/c1-2-3-4-5-12-26-13-10-18(11-14-26)21-17-27(25)22-9-8-19(16-20(21)22)24(28)23-7-6-15-29-23/h6-10,15-17H,2-5,11-14,25H2,1H3.
What are the key properties of [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone?
[1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone has a molecular weight of 391.52 g/mol, XLogP of 4.85, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-3-(1-hexyl-3,6-dihydro-2H-pyridin-4-yl)indol-5-yl]-(furan-2-yl)methanone is sourced from PubChem (CID 150034407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).