C22H21N5O2 — CID 150036852
N-[(2-amino-4-pyridinyl)methyl]-3-(methoxymethyl)-1-phenylindazole-6-carboxamide (PubChem CID 150036852) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[(2-amino-4-pyridinyl)methyl]-3-(methoxymethyl)-1-phenylindazole-6-carboxamide.
| Compound Name | N-[(2-amino-4-pyridinyl)methyl]-3-(methoxymethyl)-1-phenylindazole-6-carboxamide |
|---|---|
| PubChem CID | 150036852 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(2-amino-4-pyridinyl)methyl]-3-(methoxymethyl)-1-phenylindazole-6-carboxamide |
| SMILES | COCc1nn(-c2ccccc2)c2cc(C(=O)NCc3ccnc(N)c3)ccc12 |
| InChI | InChI=1S/C22H21N5O2/c1-29-14-19-18-8-7-16(22(28)25-13-15-9-10-24-21(23)11-15)12-20(18)27(26-19)17-5-3-2-4-6-17/h2-12H,13-14H2,1H3,(H2,23,24)(H,25,28) |
| InChIKey | DILBZOKKHZHIBT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |