C18H30N4O — CID 150037240
1,2-dimethyl-3-(2-morpholin-4-ylphenyl)-1-pentylguanidine (PubChem CID 150037240) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-morpholin-4-ylphenyl)-1-pentylguanidine.
| Compound Name | 1,2-dimethyl-3-(2-morpholin-4-ylphenyl)-1-pentylguanidine |
|---|---|
| PubChem CID | 150037240 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 1,2-dimethyl-3-(2-morpholin-4-ylphenyl)-1-pentylguanidine |
| SMILES | CCCCCN(C)/C(=N\C)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C18H30N4O/c1-4-5-8-11-21(3)18(19-2)20-16-9-6-7-10-17(16)22-12-14-23-15-13-22/h6-7,9-10H,4-5,8,11-15H2,1-3H3,(H,19,20) |
| InChIKey | DINDIWUZFLRNQW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|