C24H44N2O3 — CID 150040596
N'-[2-(2-phenylethyl)-2-(trimethoxymethyl)decyl]ethane-1,2-diamine (PubChem CID 150040596) has the molecular formula C24H44N2O3 and a molecular weight of 408.63 g/mol. Its IUPAC name is N'-[2-(2-phenylethyl)-2-(trimethoxymethyl)decyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2-phenylethyl)-2-(trimethoxymethyl)decyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 150040596 |
| Molecular Formula | C24H44N2O3 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | N'-[2-(2-phenylethyl)-2-(trimethoxymethyl)decyl]ethane-1,2-diamine |
| SMILES | CCCCCCCCC(CCc1ccccc1)(CNCCN)C(OC)(OC)OC |
| InChI | InChI=1S/C24H44N2O3/c1-5-6-7-8-9-13-17-23(21-26-20-19-25,24(27-2,28-3)29-4)18-16-22-14-11-10-12-15-22/h10-12,14-15,26H,5-9,13,16-21,25H2,1-4H3 |
| InChIKey | DJEUPJAFPFEAQG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|