C23H22F7N3O3 — CID 150042610
1-[7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl]-4,4,5,5,5-pentafluoro-2,2-dimethylpentane-1,3-dione (PubChem CID 150042610) has the molecular formula C23H22F7N3O3 and a molecular weight of 521.43 g/mol. Its IUPAC name is 1-[7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl]-4,4,5,5,5-pentafluoro-2,2-dimethylpentane-1,3-dione.
| Compound Name | 1-[7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl]-4,4,5,5,5-pentafluoro-2,2-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 150042610 |
| Molecular Formula | C23H22F7N3O3 |
| Molecular Weight | 521.43 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-[7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6,8-difluoro-4-oxoquinolin-3-yl]-4,4,5,5,5-pentafluoro-2,2-dimethylpentane-1,3-dione |
| SMILES | CC(C)(C(=O)c1cn(C2CC2)c2c(F)c(N3CCC(N)C3)c(F)cc2c1=O)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H22F7N3O3/c1-21(2,20(36)22(26,27)23(28,29)30)19(35)13-9-33(11-3-4-11)16-12(18(13)34)7-14(24)17(15(16)25)32-6-5-10(31)8-32/h7,9-11H,3-6,8,31H2,1-2H3 |
| InChIKey | DJPLPTFFMNZVHY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|