About benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate
benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 150043418) has the molecular formula C17H16ClNO2
and a molecular weight of 301.77 g/mol. Its IUPAC name is benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| PubChem CID | 150043418 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C17H16ClNO2/c18-16-8-4-7-14-9-10-19(11-15(14)16)17(20)21-12-13-5-2-1-3-6-13/h1-8H,9-12H2 |
| InChIKey | DJTREYRZRAYAEW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 150043418) is benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate is O=C(OCc1ccccc1)N1CCc2cccc(Cl)c2C1.
What is the InChIKey of benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is DJTREYRZRAYAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClNO2/c18-16-8-4-7-14-9-10-19(11-15(14)16)17(20)21-12-13-5-2-1-3-6-13/h1-8H,9-12H2.
What are the key properties of benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate?
benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 301.77 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 8-chloro-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 150043418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).