About 2-chloro-1H-1,8-naphthyridin-2-amine
2-chloro-1H-1,8-naphthyridin-2-amine (PubChem CID 150044917) has the molecular formula C8H8ClN3
and a molecular weight of 181.63 g/mol. Its IUPAC name is 2-chloro-1H-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 2-chloro-1H-1,8-naphthyridin-2-amine |
| PubChem CID | 150044917 |
| Molecular Formula | C8H8ClN3 |
| Molecular Weight | 181.63 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 2-chloro-1H-1,8-naphthyridin-2-amine |
| SMILES | NC1(Cl)C=Cc2cccnc2N1 |
| InChI | InChI=1S/C8H8ClN3/c9-8(10)4-3-6-2-1-5-11-7(6)12-8/h1-5H,10H2,(H,11,12) |
| InChIKey | DKBOGBUHNYDSLO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.63 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1H-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1H-1,8-naphthyridin-2-amine?
The IUPAC name of 2-chloro-1H-1,8-naphthyridin-2-amine (CID 150044917) is 2-chloro-1H-1,8-naphthyridin-2-amine.
What is the SMILES notation for 2-chloro-1H-1,8-naphthyridin-2-amine?
The canonical SMILES for 2-chloro-1H-1,8-naphthyridin-2-amine is NC1(Cl)C=Cc2cccnc2N1.
What is the InChIKey of 2-chloro-1H-1,8-naphthyridin-2-amine?
The InChIKey is DKBOGBUHNYDSLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClN3/c9-8(10)4-3-6-2-1-5-11-7(6)12-8/h1-5H,10H2,(H,11,12).
What are the key properties of 2-chloro-1H-1,8-naphthyridin-2-amine?
2-chloro-1H-1,8-naphthyridin-2-amine has a molecular weight of 181.63 g/mol, XLogP of 1.37, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1H-1,8-naphthyridin-2-amine is sourced from PubChem (CID 150044917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).