C18H22O4 — CID 15004564
(1E)-1-hex-5-enylidene-5,6-dimethoxyspiro[2,3-dihydroindene-7,2'-oxirane]-4-one (PubChem CID 15004564) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1E)-1-hex-5-enylidene-5,6-dimethoxyspiro[2,3-dihydroindene-7,2'-oxirane]-4-one.
| Compound Name | (1E)-1-hex-5-enylidene-5,6-dimethoxyspiro[2,3-dihydroindene-7,2'-oxirane]-4-one |
|---|---|
| PubChem CID | 15004564 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1E)-1-hex-5-enylidene-5,6-dimethoxyspiro[2,3-dihydroindene-7,2'-oxirane]-4-one |
| SMILES | C=CCCC/C=C1\CCC2=C1C1(CO1)C(OC)=C(OC)C2=O |
| InChI | InChI=1S/C18H22O4/c1-4-5-6-7-8-12-9-10-13-14(12)18(11-22-18)17(21-3)16(20-2)15(13)19/h4,8H,1,5-7,9-11H2,2-3H3/b12-8+ |
| InChIKey | UAJWCNSQCBTCCN-XYOKQWHBSA-N |
| XLogP | 3.22 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|