C16H20O4 — CID 15004572
(3E)-5,6-dimethoxy-3-pentylidene-1,2-dihydroindene-4,7-dione (PubChem CID 15004572) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3E)-5,6-dimethoxy-3-pentylidene-1,2-dihydroindene-4,7-dione.
| Compound Name | (3E)-5,6-dimethoxy-3-pentylidene-1,2-dihydroindene-4,7-dione |
|---|---|
| PubChem CID | 15004572 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3E)-5,6-dimethoxy-3-pentylidene-1,2-dihydroindene-4,7-dione |
| SMILES | CCCC/C=C1\CCC2=C1C(=O)C(OC)=C(OC)C2=O |
| InChI | InChI=1S/C16H20O4/c1-4-5-6-7-10-8-9-11-12(10)14(18)16(20-3)15(19-2)13(11)17/h7H,4-6,8-9H2,1-3H3/b10-7+ |
| InChIKey | YQHGNJBMRTUGCK-JXMROGBWSA-N |
| XLogP | 2.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|