About 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan
2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan (PubChem CID 150048162) has the molecular formula C14H22O2S
and a molecular weight of 254.39 g/mol. Its IUPAC name is 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan.
Molecular Properties
| Compound Name | 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan |
| PubChem CID | 150048162 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan |
| SMILES | CC1=CCC(C)(CSCC2(C)CC=C(C)O2)O1 |
| InChI | InChI=1S/C14H22O2S/c1-11-5-7-13(3,15-11)9-17-10-14(4)8-6-12(2)16-14/h5-6H,7-10H2,1-4H3 |
| InChIKey | DKSOFZYRWXBFMA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan?
The IUPAC name of 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan (CID 150048162) is 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan.
What is the SMILES notation for 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan?
The canonical SMILES for 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan is CC1=CCC(C)(CSCC2(C)CC=C(C)O2)O1.
What is the InChIKey of 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan?
The InChIKey is DKSOFZYRWXBFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2S/c1-11-5-7-13(3,15-11)9-17-10-14(4)8-6-12(2)16-14/h5-6H,7-10H2,1-4H3.
What are the key properties of 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan?
2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan has a molecular weight of 254.39 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethyl-3H-furan-2-yl)methylsulfanylmethyl]-2,5-dimethyl-3H-furan is sourced from PubChem (CID 150048162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).