About 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide
4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide (PubChem CID 150050775) has the molecular formula C17H23N3O
and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide |
| PubChem CID | 150050775 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC2(N)C=CC=CC2N)cc1 |
| InChI | InChI=1S/C17H23N3O/c1-16(2,3)13-9-7-12(8-10-13)15(21)20-17(19)11-5-4-6-14(17)18/h4-11,14H,18-19H2,1-3H3,(H,20,21) |
| InChIKey | DLGRVTNJXFGQEA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide?
The IUPAC name of 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide (CID 150050775) is 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide.
What is the SMILES notation for 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide?
The canonical SMILES for 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide is CC(C)(C)c1ccc(C(=O)NC2(N)C=CC=CC2N)cc1.
What is the InChIKey of 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide?
The InChIKey is DLGRVTNJXFGQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O/c1-16(2,3)13-9-7-12(8-10-13)15(21)20-17(19)11-5-4-6-14(17)18/h4-11,14H,18-19H2,1-3H3,(H,20,21).
What are the key properties of 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide?
4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide has a molecular weight of 285.39 g/mol, XLogP of 1.82, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(1,6-diaminocyclohexa-2,4-dien-1-yl)benzamide is sourced from PubChem (CID 150050775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).