About 4-(diethylamino)butyl 3-oxobutanoate
4-(diethylamino)butyl 3-oxobutanoate (PubChem CID 150051023) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 4-(diethylamino)butyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 4-(diethylamino)butyl 3-oxobutanoate |
| PubChem CID | 150051023 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 4-(diethylamino)butyl 3-oxobutanoate |
| SMILES | CCN(CC)CCCCOC(=O)CC(C)=O |
| InChI | InChI=1S/C12H23NO3/c1-4-13(5-2)8-6-7-9-16-12(15)10-11(3)14/h4-10H2,1-3H3 |
| InChIKey | DLHZHECUWCEZHP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethylamino)butyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethylamino)butyl 3-oxobutanoate?
The IUPAC name of 4-(diethylamino)butyl 3-oxobutanoate (CID 150051023) is 4-(diethylamino)butyl 3-oxobutanoate.
What is the SMILES notation for 4-(diethylamino)butyl 3-oxobutanoate?
The canonical SMILES for 4-(diethylamino)butyl 3-oxobutanoate is CCN(CC)CCCCOC(=O)CC(C)=O.
What is the InChIKey of 4-(diethylamino)butyl 3-oxobutanoate?
The InChIKey is DLHZHECUWCEZHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-4-13(5-2)8-6-7-9-16-12(15)10-11(3)14/h4-10H2,1-3H3.
What are the key properties of 4-(diethylamino)butyl 3-oxobutanoate?
4-(diethylamino)butyl 3-oxobutanoate has a molecular weight of 229.32 g/mol, XLogP of 1.63, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)butyl 3-oxobutanoate is sourced from PubChem (CID 150051023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).