About N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide
N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide (PubChem CID 150052761) has the molecular formula C14H12N2O4
and a molecular weight of 272.26 g/mol. Its IUPAC name is N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide |
| PubChem CID | 150052761 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide |
| SMILES | O=C1CC[C@H](NC(=O)c2coc3ccccc23)C(=O)N1 |
| InChI | InChI=1S/C14H12N2O4/c17-12-6-5-10(14(19)16-12)15-13(18)9-7-20-11-4-2-1-3-8(9)11/h1-4,7,10H,5-6H2,(H,15,18)(H,16,17,19)/t10-/m0/s1 |
| InChIKey | DLQXJRQBPBIMKG-JTQLQIEISA-N |
| XLogP | 0.97 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide?
The IUPAC name of N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide (CID 150052761) is N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide.
What is the SMILES notation for N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide?
The canonical SMILES for N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide is O=C1CC[C@H](NC(=O)c2coc3ccccc23)C(=O)N1.
What is the InChIKey of N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide?
The InChIKey is DLQXJRQBPBIMKG-JTQLQIEISA-N. The full InChI is InChI=1S/C14H12N2O4/c17-12-6-5-10(14(19)16-12)15-13(18)9-7-20-11-4-2-1-3-8(9)11/h1-4,7,10H,5-6H2,(H,15,18)(H,16,17,19)/t10-/m0/s1.
What are the key properties of N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide?
N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide has a molecular weight of 272.26 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-2,6-dioxopiperidin-3-yl]-1-benzofuran-3-carboxamide is sourced from PubChem (CID 150052761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).