About 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile
2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile (PubChem CID 15005423) has the molecular formula C9H6N2S2
and a molecular weight of 206.30 g/mol. Its IUPAC name is 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile |
| PubChem CID | 15005423 |
| Molecular Formula | C9H6N2S2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile |
| SMILES | CSc1sc2cccnc2c1C#N |
| InChI | InChI=1S/C9H6N2S2/c1-12-9-6(5-10)8-7(13-9)3-2-4-11-8/h2-4H,1H3 |
| InChIKey | NTFUXHOTRGKDDW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile?
The IUPAC name of 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile (CID 15005423) is 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile.
What is the SMILES notation for 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile?
The canonical SMILES for 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile is CSc1sc2cccnc2c1C#N.
What is the InChIKey of 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile?
The InChIKey is NTFUXHOTRGKDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2S2/c1-12-9-6(5-10)8-7(13-9)3-2-4-11-8/h2-4H,1H3.
What are the key properties of 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile?
2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile has a molecular weight of 206.30 g/mol, XLogP of 2.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylthieno[3,2-b]pyridine-3-carbonitrile is sourced from PubChem (CID 15005423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).