C22H24Cl2N2O2 — CID 15005471
2-(3,4-dichlorophenyl)-1-[8-hydroxy-1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 15005471) has the molecular formula C22H24Cl2N2O2 and a molecular weight of 419.35 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-[8-hydroxy-1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-[8-hydroxy-1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 15005471 |
| Molecular Formula | C22H24Cl2N2O2 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-[8-hydroxy-1-(pyrrolidin-1-ylmethyl)-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N1CCc2cccc(O)c2C1CN1CCCC1 |
| InChI | InChI=1S/C22H24Cl2N2O2/c23-17-7-6-15(12-18(17)24)13-21(28)26-11-8-16-4-3-5-20(27)22(16)19(26)14-25-9-1-2-10-25/h3-7,12,19,27H,1-2,8-11,13-14H2 |
| InChIKey | JKHTXFZUBXVUAC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|