C15H17N3O2 — CID 15005601
7-(5-hydroxypentyl)-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 15005601) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 7-(5-hydroxypentyl)-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7-(5-hydroxypentyl)-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 15005601 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 7-(5-hydroxypentyl)-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | O=c1[nH]c2cc3cc(CCCCCO)ccc3nc2[nH]1 |
| InChI | InChI=1S/C15H17N3O2/c19-7-3-1-2-4-10-5-6-12-11(8-10)9-13-14(16-12)18-15(20)17-13/h5-6,8-9,19H,1-4,7H2,(H2,16,17,18,20) |
| InChIKey | YUYJVWMDBVJKPA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|