C22H28N4O2 — CID 15005605
N-cyclohexyl-N-methyl-5-(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)pentanamide (PubChem CID 15005605) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-5-(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)pentanamide.
| Compound Name | N-cyclohexyl-N-methyl-5-(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)pentanamide |
|---|---|
| PubChem CID | 15005605 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | N-cyclohexyl-N-methyl-5-(2-oxo-1,3-dihydroimidazo[4,5-b]quinolin-7-yl)pentanamide |
| SMILES | CN(C(=O)CCCCc1ccc2nc3[nH]c(=O)[nH]c3cc2c1)C1CCCCC1 |
| InChI | InChI=1S/C22H28N4O2/c1-26(17-8-3-2-4-9-17)20(27)10-6-5-7-15-11-12-18-16(13-15)14-19-21(23-18)25-22(28)24-19/h11-14,17H,2-10H2,1H3,(H2,23,24,25,28) |
| InChIKey | OPXJIJPVHIVMBI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|