C26H37N5O3 — CID 15005614
7-[4-oxo-4-[4-(2-propylpentyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 15005614) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is 7-[4-oxo-4-[4-(2-propylpentyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7-[4-oxo-4-[4-(2-propylpentyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 15005614 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 7-[4-oxo-4-[4-(2-propylpentyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | CCCC(CCC)CN1CCN(C(=O)CCCOc2ccc3nc4[nH]c(=O)[nH]c4cc3c2)CC1 |
| InChI | InChI=1S/C26H37N5O3/c1-3-6-19(7-4-2)18-30-11-13-31(14-12-30)24(32)8-5-15-34-21-9-10-22-20(16-21)17-23-25(27-22)29-26(33)28-23/h9-10,16-17,19H,3-8,11-15,18H2,1-2H3,(H2,27,28,29,33) |
| InChIKey | JJJXUOUQDVSTMK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|