C23H25N5O3S — CID 15005630
7-[4-oxo-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 15005630) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is 7-[4-oxo-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7-[4-oxo-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 15005630 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 7-[4-oxo-4-[4-(thiophen-2-ylmethyl)piperazin-1-yl]butoxy]-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | O=C(CCCOc1ccc2nc3[nH]c(=O)[nH]c3cc2c1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C23H25N5O3S/c29-21(28-9-7-27(8-10-28)15-18-3-2-12-32-18)4-1-11-31-17-5-6-19-16(13-17)14-20-22(24-19)26-23(30)25-20/h2-3,5-6,12-14H,1,4,7-11,15H2,(H2,24,25,26,30) |
| InChIKey | NZAZIIHJOCOETH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|