C28H32N4O7 — CID 15005737
3-O-(1-benzylpiperidin-4-yl) 5-O-propan-2-yl 6-methyl-4-(2-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate (PubChem CID 15005737) has the molecular formula C28H32N4O7 and a molecular weight of 536.59 g/mol. Its IUPAC name is 3-O-(1-benzylpiperidin-4-yl) 5-O-propan-2-yl 6-methyl-4-(2-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate.
| Compound Name | 3-O-(1-benzylpiperidin-4-yl) 5-O-propan-2-yl 6-methyl-4-(2-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 15005737 |
| Molecular Formula | C28H32N4O7 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 3-O-(1-benzylpiperidin-4-yl) 5-O-propan-2-yl 6-methyl-4-(2-nitrophenyl)-2-oxo-1,4-dihydropyrimidine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC(C)C)C(c2ccccc2[N+](=O)[O-])N(C(=O)OC2CCN(Cc3ccccc3)CC2)C(=O)N1 |
| InChI | InChI=1S/C28H32N4O7/c1-18(2)38-26(33)24-19(3)29-27(34)31(25(24)22-11-7-8-12-23(22)32(36)37)28(35)39-21-13-15-30(16-14-21)17-20-9-5-4-6-10-20/h4-12,18,21,25H,13-17H2,1-3H3,(H,29,34) |
| InChIKey | DYPZUUPZRIXBQY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|