About 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane
3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane (PubChem CID 15006251) has the molecular formula C21H28BrP
and a molecular weight of 391.33 g/mol. Its IUPAC name is 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane.
Molecular Properties
| Compound Name | 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane |
| PubChem CID | 15006251 |
| Molecular Formula | C21H28BrP |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane |
| SMILES | Cc1cc(C)c(P(CCCBr)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C21H28BrP/c1-14-10-16(3)20(17(4)11-14)23(9-7-8-22)21-18(5)12-15(2)13-19(21)6/h10-13H,7-9H2,1-6H3 |
| InChIKey | ZRMFXLOOAZNZHJ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane?
The IUPAC name of 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane (CID 15006251) is 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane.
What is the SMILES notation for 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane?
The canonical SMILES for 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane is Cc1cc(C)c(P(CCCBr)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane?
The InChIKey is ZRMFXLOOAZNZHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28BrP/c1-14-10-16(3)20(17(4)11-14)23(9-7-8-22)21-18(5)12-15(2)13-19(21)6/h10-13H,7-9H2,1-6H3.
What are the key properties of 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane?
3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane has a molecular weight of 391.33 g/mol, XLogP of 5.75, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopropyl-bis(2,4,6-trimethylphenyl)phosphane is sourced from PubChem (CID 15006251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).