About [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate
[3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate (PubChem CID 150065699) has the molecular formula C17H23N3O3
and a molecular weight of 317.39 g/mol. Its IUPAC name is [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate.
Molecular Properties
| Compound Name | [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate |
| PubChem CID | 150065699 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate |
| SMILES | Cc1cc(C)c(C(C)(C)CC=O)c(OC(=O)CCCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C17H23N3O3/c1-12-10-13(2)16(17(3,4)7-9-21)14(11-12)23-15(22)6-5-8-19-20-18/h9-11H,5-8H2,1-4H3 |
| InChIKey | DOFRQZWIFHBGOZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate?
The IUPAC name of [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate (CID 150065699) is [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate.
What is the SMILES notation for [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate?
The canonical SMILES for [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate is Cc1cc(C)c(C(C)(C)CC=O)c(OC(=O)CCCN=[N+]=[N-])c1.
What is the InChIKey of [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate?
The InChIKey is DOFRQZWIFHBGOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O3/c1-12-10-13(2)16(17(3,4)7-9-21)14(11-12)23-15(22)6-5-8-19-20-18/h9-11H,5-8H2,1-4H3.
What are the key properties of [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate?
[3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate has a molecular weight of 317.39 g/mol, XLogP of 4.17, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-2-(2-methyl-4-oxobutan-2-yl)phenyl] 4-azidobutanoate is sourced from PubChem (CID 150065699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).