About 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol
2-ethyl-4,5-dihydro-1H-imidazole-5-thiol (PubChem CID 150065856) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol.
Molecular Properties
| Compound Name | 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol |
| PubChem CID | 150065856 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol |
| SMILES | CCC1=NCC(S)N1 |
| InChI | InChI=1S/C5H10N2S/c1-2-4-6-3-5(8)7-4/h5,8H,2-3H2,1H3,(H,6,7) |
| InChIKey | DOGNIMMFGPWMDL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol?
The IUPAC name of 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol (CID 150065856) is 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol.
What is the SMILES notation for 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol?
The canonical SMILES for 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol is CCC1=NCC(S)N1.
What is the InChIKey of 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol?
The InChIKey is DOGNIMMFGPWMDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S/c1-2-4-6-3-5(8)7-4/h5,8H,2-3H2,1H3,(H,6,7).
What are the key properties of 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol?
2-ethyl-4,5-dihydro-1H-imidazole-5-thiol has a molecular weight of 130.22 g/mol, XLogP of 0.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,5-dihydro-1H-imidazole-5-thiol is sourced from PubChem (CID 150065856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).