C10H10F12O — CID 15006624
1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-propoxyheptane (PubChem CID 15006624) has the molecular formula C10H10F12O and a molecular weight of 374.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-propoxyheptane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-propoxyheptane |
|---|---|
| PubChem CID | 15006624 |
| Molecular Formula | C10H10F12O |
| Molecular Weight | 374.17 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoro-7-propoxyheptane |
| SMILES | CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H10F12O/c1-2-3-23-4-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h5H,2-4H2,1H3 |
| InChIKey | VJCNARBEGLOJOX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.17 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|