About dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate
dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate (PubChem CID 15006637) has the molecular formula C10H14F4O4
and a molecular weight of 274.21 g/mol. Its IUPAC name is dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate.
Molecular Properties
| Compound Name | dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate |
| PubChem CID | 15006637 |
| Molecular Formula | C10H14F4O4 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate |
| SMILES | COC(=O)C(CC(F)F)C(CC(F)F)C(=O)OC |
| InChI | InChI=1S/C10H14F4O4/c1-17-9(15)5(3-7(11)12)6(4-8(13)14)10(16)18-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | OTSAQFVRNRJIGB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate?
The IUPAC name of dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate (CID 15006637) is dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate.
What is the SMILES notation for dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate?
The canonical SMILES for dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate is COC(=O)C(CC(F)F)C(CC(F)F)C(=O)OC.
What is the InChIKey of dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate?
The InChIKey is OTSAQFVRNRJIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F4O4/c1-17-9(15)5(3-7(11)12)6(4-8(13)14)10(16)18-2/h5-8H,3-4H2,1-2H3.
What are the key properties of dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate?
dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate has a molecular weight of 274.21 g/mol, XLogP of 1.88, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,3-bis(2,2-difluoroethyl)butanedioate is sourced from PubChem (CID 15006637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).