About propan-2-yl (2R)-2-phenylbutanoate
propan-2-yl (2R)-2-phenylbutanoate (PubChem CID 15006686) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is propan-2-yl (2R)-2-phenylbutanoate.
Molecular Properties
| Compound Name | propan-2-yl (2R)-2-phenylbutanoate |
| PubChem CID | 15006686 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | propan-2-yl (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)OC(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-4-12(13(14)15-10(2)3)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3/t12-/m1/s1 |
| InChIKey | CNFICIURFRWLFF-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl (2R)-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2R)-2-phenylbutanoate?
The IUPAC name of propan-2-yl (2R)-2-phenylbutanoate (CID 15006686) is propan-2-yl (2R)-2-phenylbutanoate.
What is the SMILES notation for propan-2-yl (2R)-2-phenylbutanoate?
The canonical SMILES for propan-2-yl (2R)-2-phenylbutanoate is CC[C@@H](C(=O)OC(C)C)c1ccccc1.
What is the InChIKey of propan-2-yl (2R)-2-phenylbutanoate?
The InChIKey is CNFICIURFRWLFF-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H18O2/c1-4-12(13(14)15-10(2)3)11-8-6-5-7-9-11/h5-10,12H,4H2,1-3H3/t12-/m1/s1.
What are the key properties of propan-2-yl (2R)-2-phenylbutanoate?
propan-2-yl (2R)-2-phenylbutanoate has a molecular weight of 206.28 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2R)-2-phenylbutanoate is sourced from PubChem (CID 15006686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).