C30H32BN3O6S — CID 150066926
4-methyl-8-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one (PubChem CID 150066926) has the molecular formula C30H32BN3O6S and a molecular weight of 573.48 g/mol. Its IUPAC name is 4-methyl-8-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one.
| Compound Name | 4-methyl-8-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 150066926 |
| Molecular Formula | C30H32BN3O6S |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 4-methyl-8-[1-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-b]pyridin-3-yl]-2,3-dihydro-1,4-benzoxazepin-5-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccc4c(c3)OCCN(C)C4=O)c3cc(B4OC(C)(C)C(C)(C)O4)cnc32)cc1 |
| InChI | InChI=1S/C30H32BN3O6S/c1-19-7-10-22(11-8-19)41(36,37)34-18-25(20-9-12-23-26(15-20)38-14-13-33(6)28(23)35)24-16-21(17-32-27(24)34)31-39-29(2,3)30(4,5)40-31/h7-12,15-18H,13-14H2,1-6H3 |
| InChIKey | DOLWTJDWRSHGCJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|