C8H10N2O — CID 150067898
1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde (PubChem CID 150067898) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde.
| Compound Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 150067898 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1,2,3,5-tetrahydroimidazo[1,2-a]pyridine-2-carbaldehyde |
| SMILES | O=CC1CN2CC=CC=C2N1 |
| InChI | InChI=1S/C8H10N2O/c11-6-7-5-10-4-2-1-3-8(10)9-7/h1-3,6-7,9H,4-5H2 |
| InChIKey | DOQSLWRCIAYBEF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|