About 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol
3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol (PubChem CID 15006904) has the molecular formula C23H19NOS
and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol.
Molecular Properties
| Compound Name | 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol |
| PubChem CID | 15006904 |
| Molecular Formula | C23H19NOS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol |
| SMILES | Oc1cccc(CCc2nc(-c3ccccc3)c(-c3ccccc3)s2)c1 |
| InChI | InChI=1S/C23H19NOS/c25-20-13-7-8-17(16-20)14-15-21-24-22(18-9-3-1-4-10-18)23(26-21)19-11-5-2-6-12-19/h1-13,16,25H,14-15H2 |
| InChIKey | DHCIDABYVHTUDK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol?
The IUPAC name of 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol (CID 15006904) is 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol.
What is the SMILES notation for 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol?
The canonical SMILES for 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol is Oc1cccc(CCc2nc(-c3ccccc3)c(-c3ccccc3)s2)c1.
What is the InChIKey of 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol?
The InChIKey is DHCIDABYVHTUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NOS/c25-20-13-7-8-17(16-20)14-15-21-24-22(18-9-3-1-4-10-18)23(26-21)19-11-5-2-6-12-19/h1-13,16,25H,14-15H2.
What are the key properties of 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol?
3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol has a molecular weight of 357.48 g/mol, XLogP of 5.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4,5-diphenyl-1,3-thiazol-2-yl)ethyl]phenol is sourced from PubChem (CID 15006904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).