C20H18ClFN2O4S — CID 150069448
[benzenesulfonyl-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-7-yl)-fluoromethyl] acetate (PubChem CID 150069448) has the molecular formula C20H18ClFN2O4S and a molecular weight of 436.89 g/mol. Its IUPAC name is [benzenesulfonyl-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-7-yl)-fluoromethyl] acetate.
| Compound Name | [benzenesulfonyl-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-7-yl)-fluoromethyl] acetate |
|---|---|
| PubChem CID | 150069448 |
| Molecular Formula | C20H18ClFN2O4S |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | [benzenesulfonyl-(2-chloro-6,7,8,9-tetrahydro-5H-pyrido[3,2-b]indol-7-yl)-fluoromethyl] acetate |
| SMILES | CC(=O)OC(F)(C1CCc2c([nH]c3ccc(Cl)nc23)C1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18ClFN2O4S/c1-12(25)28-20(22,29(26,27)14-5-3-2-4-6-14)13-7-8-15-17(11-13)23-16-9-10-18(21)24-19(15)16/h2-6,9-10,13,23H,7-8,11H2,1H3 |
| InChIKey | DOYOOMMQJGFGOZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|