About 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid
3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid (PubChem CID 15007135) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid |
| PubChem CID | 15007135 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid |
| SMILES | Cc1oncc1C(=O)NCCC(=O)O |
| InChI | InChI=1S/C8H10N2O4/c1-5-6(4-10-14-5)8(13)9-3-2-7(11)12/h4H,2-3H2,1H3,(H,9,13)(H,11,12) |
| InChIKey | DBVRNDLCWSOIQE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid?
The IUPAC name of 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid (CID 15007135) is 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid.
What is the SMILES notation for 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid?
The canonical SMILES for 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid is Cc1oncc1C(=O)NCCC(=O)O.
What is the InChIKey of 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid?
The InChIKey is DBVRNDLCWSOIQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-5-6(4-10-14-5)8(13)9-3-2-7(11)12/h4H,2-3H2,1H3,(H,9,13)(H,11,12).
What are the key properties of 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid?
3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid has a molecular weight of 198.18 g/mol, XLogP of 0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,2-oxazole-4-carbonyl)amino]propanoic acid is sourced from PubChem (CID 15007135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).