C23H36BNO6Si — CID 150071899
(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]propanoic acid (PubChem CID 150071899) has the molecular formula C23H36BNO6Si and a molecular weight of 461.44 g/mol. Its IUPAC name is (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]propanoic acid.
| Compound Name | (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 150071899 |
| Molecular Formula | C23H36BNO6Si |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[3-oxo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]propanoic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(=O)N([C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)O)C3)OC1(C)C |
| InChI | InChI=1S/C23H36BNO6Si/c1-21(2,3)32(8,9)29-14-18(20(27)28)25-13-15-10-11-16(12-17(15)19(25)26)24-30-22(4,5)23(6,7)31-24/h10-12,18H,13-14H2,1-9H3,(H,27,28)/t18-/m0/s1 |
| InChIKey | DPLPHUKEUJJMBT-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|