About 2-(oxolan-3-yloxy)oxane
2-(oxolan-3-yloxy)oxane (PubChem CID 150073017) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-(oxolan-3-yloxy)oxane.
Molecular Properties
| Compound Name | 2-(oxolan-3-yloxy)oxane |
| PubChem CID | 150073017 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-(oxolan-3-yloxy)oxane |
| SMILES | C1CCC(OC2CCOC2)OC1 |
| InChI | InChI=1S/C9H16O3/c1-2-5-11-9(3-1)12-8-4-6-10-7-8/h8-9H,1-7H2 |
| InChIKey | DPRDHJGMLALGEA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxolan-3-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-3-yloxy)oxane?
The IUPAC name of 2-(oxolan-3-yloxy)oxane (CID 150073017) is 2-(oxolan-3-yloxy)oxane.
What is the SMILES notation for 2-(oxolan-3-yloxy)oxane?
The canonical SMILES for 2-(oxolan-3-yloxy)oxane is C1CCC(OC2CCOC2)OC1.
What is the InChIKey of 2-(oxolan-3-yloxy)oxane?
The InChIKey is DPRDHJGMLALGEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-2-5-11-9(3-1)12-8-4-6-10-7-8/h8-9H,1-7H2.
What are the key properties of 2-(oxolan-3-yloxy)oxane?
2-(oxolan-3-yloxy)oxane has a molecular weight of 172.22 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-3-yloxy)oxane is sourced from PubChem (CID 150073017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).