About 2,3-diphosphorosopyrazine
2,3-diphosphorosopyrazine (PubChem CID 150073121) has the molecular formula C4H2N2O2P2
and a molecular weight of 172.02 g/mol. Its IUPAC name is 2,3-diphosphorosopyrazine.
Molecular Properties
| Compound Name | 2,3-diphosphorosopyrazine |
| PubChem CID | 150073121 |
| Molecular Formula | C4H2N2O2P2 |
| Molecular Weight | 172.02 g/mol |
| Exact Mass | 171.96 |
| IUPAC Name | 2,3-diphosphorosopyrazine |
| SMILES | O=Pc1nccnc1P=O |
| InChI | InChI=1S/C4H2N2O2P2/c7-9-3-4(10-8)6-2-1-5-3/h1-2H |
| InChIKey | DPRSUNYDJFBEML-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.02 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diphosphorosopyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphosphorosopyrazine?
The IUPAC name of 2,3-diphosphorosopyrazine (CID 150073121) is 2,3-diphosphorosopyrazine.
What is the SMILES notation for 2,3-diphosphorosopyrazine?
The canonical SMILES for 2,3-diphosphorosopyrazine is O=Pc1nccnc1P=O.
What is the InChIKey of 2,3-diphosphorosopyrazine?
The InChIKey is DPRSUNYDJFBEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N2O2P2/c7-9-3-4(10-8)6-2-1-5-3/h1-2H.
What are the key properties of 2,3-diphosphorosopyrazine?
2,3-diphosphorosopyrazine has a molecular weight of 172.02 g/mol, XLogP of 0.31, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphosphorosopyrazine is sourced from PubChem (CID 150073121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).