C12H12F3N3 — CID 150074108
N-benzyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine (PubChem CID 150074108) has the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-benzyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine.
| Compound Name | N-benzyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 150074108 |
| Molecular Formula | C12H12F3N3 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-benzyl-1-(2,2,2-trifluoroethyl)pyrazol-4-amine |
| SMILES | FC(F)(F)Cn1cc(NCc2ccccc2)cn1 |
| InChI | InChI=1S/C12H12F3N3/c13-12(14,15)9-18-8-11(7-17-18)16-6-10-4-2-1-3-5-10/h1-5,7-8,16H,6,9H2 |
| InChIKey | DPWZJDUEVQJLQP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |