C7H12N2S — CID 15007595
3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidine-1-thione (PubChem CID 15007595) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidine-1-thione.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidine-1-thione |
|---|---|
| PubChem CID | 15007595 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-pyrrolo[1,2-c]pyrimidine-1-thione |
| SMILES | S=C1NCCC2CCCN12 |
| InChI | InChI=1S/C7H12N2S/c10-7-8-4-3-6-2-1-5-9(6)7/h6H,1-5H2,(H,8,10) |
| InChIKey | BFSLZHGGBFFTJT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|