C18H19F2NOSi — CID 15008003
[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-trimethylsilane (PubChem CID 15008003) has the molecular formula C18H19F2NOSi and a molecular weight of 331.44 g/mol. Its IUPAC name is [4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-trimethylsilane.
| Compound Name | [4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 15008003 |
| Molecular Formula | C18H19F2NOSi |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(C2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C18H19F2NOSi/c1-23(2,3)13-9-7-12(8-10-13)16-11-22-18(21-16)17-14(19)5-4-6-15(17)20/h4-10,16H,11H2,1-3H3 |
| InChIKey | HTBZEOIWLXKLGO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|