C22H24F3NO — CID 15008032
2-(2,6-difluorophenyl)-4-(2-fluoro-4-heptylphenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 15008032) has the molecular formula C22H24F3NO and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-fluoro-4-heptylphenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-fluoro-4-heptylphenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 15008032 |
| Molecular Formula | C22H24F3NO |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-fluoro-4-heptylphenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCc1ccc(C2COC(c3c(F)cccc3F)=N2)c(F)c1 |
| InChI | InChI=1S/C22H24F3NO/c1-2-3-4-5-6-8-15-11-12-16(19(25)13-15)20-14-27-22(26-20)21-17(23)9-7-10-18(21)24/h7,9-13,20H,2-6,8,14H2,1H3 |
| InChIKey | RIFVBVNDPQBXJC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|